C14H22N2O3 — CID 116845415
2-[(4-methoxy-2,3,6-trimethylphenyl)methoxy]-N-methylacetohydrazide (PubChem CID 116845415) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-[(4-methoxy-2,3,6-trimethylphenyl)methoxy]-N-methylacetohydrazide.
| Compound Name | 2-[(4-methoxy-2,3,6-trimethylphenyl)methoxy]-N-methylacetohydrazide |
|---|---|
| PubChem CID | 116845415 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-[(4-methoxy-2,3,6-trimethylphenyl)methoxy]-N-methylacetohydrazide |
| SMILES | COc1cc(C)c(COCC(=O)N(C)N)c(C)c1C |
| InChI | InChI=1S/C14H22N2O3/c1-9-6-13(18-5)11(3)10(2)12(9)7-19-8-14(17)16(4)15/h6H,7-8,15H2,1-5H3 |
| InChIKey | PZOLXPQXBUCDRS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|