C12H18N2O2 — CID 116845305
2-[(3,4-dimethylphenyl)methoxy]-N-methylacetohydrazide (PubChem CID 116845305) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-[(3,4-dimethylphenyl)methoxy]-N-methylacetohydrazide.
| Compound Name | 2-[(3,4-dimethylphenyl)methoxy]-N-methylacetohydrazide |
|---|---|
| PubChem CID | 116845305 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-[(3,4-dimethylphenyl)methoxy]-N-methylacetohydrazide |
| SMILES | Cc1ccc(COCC(=O)N(C)N)cc1C |
| InChI | InChI=1S/C12H18N2O2/c1-9-4-5-11(6-10(9)2)7-16-8-12(15)14(3)13/h4-6H,7-8,13H2,1-3H3 |
| InChIKey | KGTVKLXZAOXNCP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|