C12H19NO2 — CID 102548255
1-amino-3-[(3,4-dimethylphenyl)methoxy]propan-2-ol (PubChem CID 102548255) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-amino-3-[(3,4-dimethylphenyl)methoxy]propan-2-ol.
| Compound Name | 1-amino-3-[(3,4-dimethylphenyl)methoxy]propan-2-ol |
|---|---|
| PubChem CID | 102548255 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 1-amino-3-[(3,4-dimethylphenyl)methoxy]propan-2-ol |
| SMILES | Cc1ccc(COCC(O)CN)cc1C |
| InChI | InChI=1S/C12H19NO2/c1-9-3-4-11(5-10(9)2)7-15-8-12(14)6-13/h3-5,12,14H,6-8,13H2,1-2H3 |
| InChIKey | UNVOSZSAXUJNSD-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |