C13H21NO5 — CID 97180192
(2S)-1-amino-3-[(2,4,5-trimethoxyphenyl)methoxy]propan-2-ol (PubChem CID 97180192) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is (2S)-1-amino-3-[(2,4,5-trimethoxyphenyl)methoxy]propan-2-ol.
| Compound Name | (2S)-1-amino-3-[(2,4,5-trimethoxyphenyl)methoxy]propan-2-ol |
|---|---|
| PubChem CID | 97180192 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (2S)-1-amino-3-[(2,4,5-trimethoxyphenyl)methoxy]propan-2-ol |
| SMILES | COc1cc(OC)c(OC)cc1COC[C@@H](O)CN |
| InChI | InChI=1S/C13H21NO5/c1-16-11-5-13(18-3)12(17-2)4-9(11)7-19-8-10(15)6-14/h4-5,10,15H,6-8,14H2,1-3H3/t10-/m0/s1 |
| InChIKey | NBELNFWYLZZPEJ-JTQLQIEISA-N |
| XLogP | 0.55 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |