C13H18O5 — CID 97180099
(2S)-2-[(2,4,5-trimethoxyphenyl)methoxymethyl]oxirane (PubChem CID 97180099) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is (2S)-2-[(2,4,5-trimethoxyphenyl)methoxymethyl]oxirane.
| Compound Name | (2S)-2-[(2,4,5-trimethoxyphenyl)methoxymethyl]oxirane |
|---|---|
| PubChem CID | 97180099 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (2S)-2-[(2,4,5-trimethoxyphenyl)methoxymethyl]oxirane |
| SMILES | COc1cc(OC)c(OC)cc1COC[C@@H]1CO1 |
| InChI | InChI=1S/C13H18O5/c1-14-11-5-13(16-3)12(15-2)4-9(11)6-17-7-10-8-18-10/h4-5,10H,6-8H2,1-3H3/t10-/m1/s1 |
| InChIKey | VFUFDQXQRPGMOQ-SNVBAGLBSA-N |
| XLogP | 1.63 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|