C20H26O6 — CID 57293347
2-[[2-ethenyl-3,5-bis(oxiran-2-ylmethoxymethyl)phenyl]methoxymethyl]oxirane (PubChem CID 57293347) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is 2-[[2-ethenyl-3,5-bis(oxiran-2-ylmethoxymethyl)phenyl]methoxymethyl]oxirane.
| Compound Name | 2-[[2-ethenyl-3,5-bis(oxiran-2-ylmethoxymethyl)phenyl]methoxymethyl]oxirane |
|---|---|
| PubChem CID | 57293347 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 2-[[2-ethenyl-3,5-bis(oxiran-2-ylmethoxymethyl)phenyl]methoxymethyl]oxirane |
| SMILES | C=Cc1c(COCC2CO2)cc(COCC2CO2)cc1COCC1CO1 |
| InChI | InChI=1S/C20H26O6/c1-2-20-15(6-22-9-18-12-25-18)3-14(5-21-8-17-11-24-17)4-16(20)7-23-10-19-13-26-19/h2-4,17-19H,1,5-13H2 |
| InChIKey | BWONDYSHSJIGBM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|