C22H30O8 — CID 139993716
2-[[2,4,5-tris(oxiran-2-ylmethoxymethyl)phenyl]methoxymethyl]oxirane (PubChem CID 139993716) has the molecular formula C22H30O8 and a molecular weight of 422.47 g/mol. Its IUPAC name is 2-[[2,4,5-tris(oxiran-2-ylmethoxymethyl)phenyl]methoxymethyl]oxirane.
| Compound Name | 2-[[2,4,5-tris(oxiran-2-ylmethoxymethyl)phenyl]methoxymethyl]oxirane |
|---|---|
| PubChem CID | 139993716 |
| Molecular Formula | C22H30O8 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 2-[[2,4,5-tris(oxiran-2-ylmethoxymethyl)phenyl]methoxymethyl]oxirane |
| SMILES | c1c(COCC2CO2)c(COCC2CO2)cc(COCC2CO2)c1COCC1CO1 |
| InChI | InChI=1S/C22H30O8/c1-15(3-23-7-19-11-27-19)17(5-25-9-21-13-29-21)2-18(6-26-10-22-14-30-22)16(1)4-24-8-20-12-28-20/h1-2,19-22H,3-14H2 |
| InChIKey | SFZOHLOCNWQROV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 87.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|