C10H10Cl2O2 — CID 97180060
(2R)-2-[(2,3-dichlorophenyl)methoxymethyl]oxirane (PubChem CID 97180060) has the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. Its IUPAC name is (2R)-2-[(2,3-dichlorophenyl)methoxymethyl]oxirane.
| Compound Name | (2R)-2-[(2,3-dichlorophenyl)methoxymethyl]oxirane |
|---|---|
| PubChem CID | 97180060 |
| Molecular Formula | C10H10Cl2O2 |
| Molecular Weight | 233.09 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | (2R)-2-[(2,3-dichlorophenyl)methoxymethyl]oxirane |
| SMILES | Clc1cccc(COC[C@H]2CO2)c1Cl |
| InChI | InChI=1S/C10H10Cl2O2/c11-9-3-1-2-7(10(9)12)4-13-5-8-6-14-8/h1-3,8H,4-6H2/t8-/m0/s1 |
| InChIKey | PZVRBSYNKUCKKV-QMMMGPOBSA-N |
| XLogP | 2.91 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.09 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|