About (2R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]oxirane
(2R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]oxirane (PubChem CID 97180096) has the molecular formula C10H9F3O2
and a molecular weight of 218.17 g/mol. Its IUPAC name is (2R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]oxirane.
Molecular Properties
| Compound Name | (2R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]oxirane |
| PubChem CID | 97180096 |
| Molecular Formula | C10H9F3O2 |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | (2R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]oxirane |
| SMILES | Fc1cc(F)c(COC[C@H]2CO2)cc1F |
| InChI | InChI=1S/C10H9F3O2/c11-8-2-10(13)9(12)1-6(8)3-14-4-7-5-15-7/h1-2,7H,3-5H2/t7-/m0/s1 |
| InChIKey | FKWUCZCEERLORZ-ZETCQYMHSA-N |
| XLogP | 2.02 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]oxirane?
The IUPAC name of (2R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]oxirane (CID 97180096) is (2R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]oxirane.
What is the SMILES notation for (2R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]oxirane?
The canonical SMILES for (2R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]oxirane is Fc1cc(F)c(COC[C@H]2CO2)cc1F.
What is the InChIKey of (2R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]oxirane?
The InChIKey is FKWUCZCEERLORZ-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H9F3O2/c11-8-2-10(13)9(12)1-6(8)3-14-4-7-5-15-7/h1-2,7H,3-5H2/t7-/m0/s1.
What are the key properties of (2R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]oxirane?
(2R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]oxirane has a molecular weight of 218.17 g/mol, XLogP of 2.02, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]oxirane is sourced from PubChem (CID 97180096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).