About 2-[[2,3-bis(oxiran-2-ylmethoxymethyl)-5-prop-1-en-2-ylphenyl]methoxymethyl]oxirane
2-[[2,3-bis(oxiran-2-ylmethoxymethyl)-5-prop-1-en-2-ylphenyl]methoxymethyl]oxirane (PubChem CID 139830660) has the molecular formula C21H28O6
and a molecular weight of 376.45 g/mol. Its IUPAC name is 2-[[2,3-bis(oxiran-2-ylmethoxymethyl)-5-prop-1-en-2-ylphenyl]methoxymethyl]oxirane.
Molecular Properties
| Compound Name | 2-[[2,3-bis(oxiran-2-ylmethoxymethyl)-5-prop-1-en-2-ylphenyl]methoxymethyl]oxirane |
| PubChem CID | 139830660 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-[[2,3-bis(oxiran-2-ylmethoxymethyl)-5-prop-1-en-2-ylphenyl]methoxymethyl]oxirane |
| SMILES | C=C(C)c1cc(COCC2CO2)c(COCC2CO2)c(COCC2CO2)c1 |
| InChI | InChI=1S/C21H28O6/c1-14(2)15-3-16(5-22-7-18-10-25-18)21(13-24-9-20-12-27-20)17(4-15)6-23-8-19-11-26-19/h3-4,18-20H,1,5-13H2,2H3 |
| InChIKey | HXTHLRDITKETFQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2,3-bis(oxiran-2-ylmethoxymethyl)-5-prop-1-en-2-ylphenyl]methoxymethyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,3-bis(oxiran-2-ylmethoxymethyl)-5-prop-1-en-2-ylphenyl]methoxymethyl]oxirane?
The IUPAC name of 2-[[2,3-bis(oxiran-2-ylmethoxymethyl)-5-prop-1-en-2-ylphenyl]methoxymethyl]oxirane (CID 139830660) is 2-[[2,3-bis(oxiran-2-ylmethoxymethyl)-5-prop-1-en-2-ylphenyl]methoxymethyl]oxirane.
What is the SMILES notation for 2-[[2,3-bis(oxiran-2-ylmethoxymethyl)-5-prop-1-en-2-ylphenyl]methoxymethyl]oxirane?
The canonical SMILES for 2-[[2,3-bis(oxiran-2-ylmethoxymethyl)-5-prop-1-en-2-ylphenyl]methoxymethyl]oxirane is C=C(C)c1cc(COCC2CO2)c(COCC2CO2)c(COCC2CO2)c1.
What is the InChIKey of 2-[[2,3-bis(oxiran-2-ylmethoxymethyl)-5-prop-1-en-2-ylphenyl]methoxymethyl]oxirane?
The InChIKey is HXTHLRDITKETFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28O6/c1-14(2)15-3-16(5-22-7-18-10-25-18)21(13-24-9-20-12-27-20)17(4-15)6-23-8-19-11-26-19/h3-4,18-20H,1,5-13H2,2H3.
What are the key properties of 2-[[2,3-bis(oxiran-2-ylmethoxymethyl)-5-prop-1-en-2-ylphenyl]methoxymethyl]oxirane?
2-[[2,3-bis(oxiran-2-ylmethoxymethyl)-5-prop-1-en-2-ylphenyl]methoxymethyl]oxirane has a molecular weight of 376.45 g/mol, XLogP of 2.47, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,3-bis(oxiran-2-ylmethoxymethyl)-5-prop-1-en-2-ylphenyl]methoxymethyl]oxirane is sourced from PubChem (CID 139830660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).