C20H26O4 — CID 166890115
2-[[4-[(Z)-3-methylidenehex-4-enyl]-3-(oxiran-2-ylmethoxymethyl)phenoxy]methyl]oxirane (PubChem CID 166890115) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is 2-[[4-[(Z)-3-methylidenehex-4-enyl]-3-(oxiran-2-ylmethoxymethyl)phenoxy]methyl]oxirane.
| Compound Name | 2-[[4-[(Z)-3-methylidenehex-4-enyl]-3-(oxiran-2-ylmethoxymethyl)phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 166890115 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-[[4-[(Z)-3-methylidenehex-4-enyl]-3-(oxiran-2-ylmethoxymethyl)phenoxy]methyl]oxirane |
| SMILES | C=C(/C=C\C)CCc1ccc(OCC2CO2)cc1COCC1CO1 |
| InChI | InChI=1S/C20H26O4/c1-3-4-15(2)5-6-16-7-8-18(22-13-20-14-24-20)9-17(16)10-21-11-19-12-23-19/h3-4,7-9,19-20H,2,5-6,10-14H2,1H3/b4-3- |
| InChIKey | AJYMKQXLNSKGEH-ARJAWSKDSA-N |
| XLogP | 3.44 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|