C20H28O6 — CID 159741748
2-[[2,3-bis(oxiran-2-ylmethoxymethyl)phenyl]methoxymethyl]oxirane;ethene (PubChem CID 159741748) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is 2-[[2,3-bis(oxiran-2-ylmethoxymethyl)phenyl]methoxymethyl]oxirane;ethene.
| Compound Name | 2-[[2,3-bis(oxiran-2-ylmethoxymethyl)phenyl]methoxymethyl]oxirane;ethene |
|---|---|
| PubChem CID | 159741748 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2-[[2,3-bis(oxiran-2-ylmethoxymethyl)phenyl]methoxymethyl]oxirane;ethene |
| SMILES | C=C.c1cc(COCC2CO2)c(COCC2CO2)c(COCC2CO2)c1 |
| InChI | InChI=1S/C18H24O6.C2H4/c1-2-13(4-19-6-15-9-22-15)18(12-21-8-17-11-24-17)14(3-1)5-20-7-16-10-23-16;1-2/h1-3,15-17H,4-12H2;1-2H2 |
| InChIKey | NCNVPZWTSRESAB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|