C12H14O2 — CID 167171988
2-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethoxymethyl)oxirane (PubChem CID 167171988) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethoxymethyl)oxirane.
| Compound Name | 2-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 167171988 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 2-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethoxymethyl)oxirane |
| SMILES | c1cc2c(cc1COCC1CO1)CC2 |
| InChI | InChI=1S/C12H14O2/c1-2-10-3-4-11(10)5-9(1)6-13-7-12-8-14-12/h1-2,5,12H,3-4,6-8H2 |
| InChIKey | XSQNWIMTQMUFIE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|