C13H18O — CID 90992767
6-(ethoxymethyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 90992767) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 6-(ethoxymethyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-(ethoxymethyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 90992767 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 6-(ethoxymethyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCOCc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C13H18O/c1-2-14-10-11-7-8-12-5-3-4-6-13(12)9-11/h7-9H,2-6,10H2,1H3 |
| InChIKey | UWUVKRUGJMLZSF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |