About 2-[2-(2,3-dihydro-1H-inden-5-ylmethoxy)ethyl]aniline
2-[2-(2,3-dihydro-1H-inden-5-ylmethoxy)ethyl]aniline (PubChem CID 102902166) has the molecular formula C18H21NO
and a molecular weight of 267.37 g/mol. Its IUPAC name is 2-[2-(2,3-dihydro-1H-inden-5-ylmethoxy)ethyl]aniline.
Molecular Properties
| Compound Name | 2-[2-(2,3-dihydro-1H-inden-5-ylmethoxy)ethyl]aniline |
| PubChem CID | 102902166 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-[2-(2,3-dihydro-1H-inden-5-ylmethoxy)ethyl]aniline |
| SMILES | Nc1ccccc1CCOCc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C18H21NO/c19-18-7-2-1-4-16(18)10-11-20-13-14-8-9-15-5-3-6-17(15)12-14/h1-2,4,7-9,12H,3,5-6,10-11,13,19H2 |
| InChIKey | FDLDWWGOQFHKMN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,3-dihydro-1H-inden-5-ylmethoxy)ethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,3-dihydro-1H-inden-5-ylmethoxy)ethyl]aniline?
The IUPAC name of 2-[2-(2,3-dihydro-1H-inden-5-ylmethoxy)ethyl]aniline (CID 102902166) is 2-[2-(2,3-dihydro-1H-inden-5-ylmethoxy)ethyl]aniline.
What is the SMILES notation for 2-[2-(2,3-dihydro-1H-inden-5-ylmethoxy)ethyl]aniline?
The canonical SMILES for 2-[2-(2,3-dihydro-1H-inden-5-ylmethoxy)ethyl]aniline is Nc1ccccc1CCOCc1ccc2c(c1)CCC2.
What is the InChIKey of 2-[2-(2,3-dihydro-1H-inden-5-ylmethoxy)ethyl]aniline?
The InChIKey is FDLDWWGOQFHKMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO/c19-18-7-2-1-4-16(18)10-11-20-13-14-8-9-15-5-3-6-17(15)12-14/h1-2,4,7-9,12H,3,5-6,10-11,13,19H2.
What are the key properties of 2-[2-(2,3-dihydro-1H-inden-5-ylmethoxy)ethyl]aniline?
2-[2-(2,3-dihydro-1H-inden-5-ylmethoxy)ethyl]aniline has a molecular weight of 267.37 g/mol, XLogP of 3.52, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,3-dihydro-1H-inden-5-ylmethoxy)ethyl]aniline is sourced from PubChem (CID 102902166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).