C17H24O2 — CID 106825329
[4-(2,3-dihydro-1H-inden-5-ylmethoxy)cyclohexyl]methanol (PubChem CID 106825329) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is [4-(2,3-dihydro-1H-inden-5-ylmethoxy)cyclohexyl]methanol.
| Compound Name | [4-(2,3-dihydro-1H-inden-5-ylmethoxy)cyclohexyl]methanol |
|---|---|
| PubChem CID | 106825329 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | [4-(2,3-dihydro-1H-inden-5-ylmethoxy)cyclohexyl]methanol |
| SMILES | OCC1CCC(OCc2ccc3c(c2)CCC3)CC1 |
| InChI | InChI=1S/C17H24O2/c18-11-13-5-8-17(9-6-13)19-12-14-4-7-15-2-1-3-16(15)10-14/h4,7,10,13,17-18H,1-3,5-6,8-9,11-12H2 |
| InChIKey | XWPCTGBEFGKSFW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |