C16H20O2 — CID 113414209
4-(2,3-dihydro-1H-inden-5-ylmethoxy)cyclohexan-1-one (PubChem CID 113414209) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-inden-5-ylmethoxy)cyclohexan-1-one.
| Compound Name | 4-(2,3-dihydro-1H-inden-5-ylmethoxy)cyclohexan-1-one |
|---|---|
| PubChem CID | 113414209 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 4-(2,3-dihydro-1H-inden-5-ylmethoxy)cyclohexan-1-one |
| SMILES | O=C1CCC(OCc2ccc3c(c2)CCC3)CC1 |
| InChI | InChI=1S/C16H20O2/c17-15-6-8-16(9-7-15)18-11-12-4-5-13-2-1-3-14(13)10-12/h4-5,10,16H,1-3,6-9,11H2 |
| InChIKey | CSTQETGMDDKYCS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |