C14H17NO — CID 8623360
N-cyclopropyl-2-(2,3-dihydro-1H-inden-5-yl)acetamide (PubChem CID 8623360) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is N-cyclopropyl-2-(2,3-dihydro-1H-inden-5-yl)acetamide.
| Compound Name | N-cyclopropyl-2-(2,3-dihydro-1H-inden-5-yl)acetamide |
|---|---|
| PubChem CID | 8623360 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | N-cyclopropyl-2-(2,3-dihydro-1H-inden-5-yl)acetamide |
| SMILES | O=C(Cc1ccc2c(c1)CCC2)NC1CC1 |
| InChI | InChI=1S/C14H17NO/c16-14(15-13-6-7-13)9-10-4-5-11-2-1-3-12(11)8-10/h4-5,8,13H,1-3,6-7,9H2,(H,15,16) |
| InChIKey | PNVGEZHSXZTTOO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |