C17H23N3OS — CID 8622189
1-cyclopentyl-3-[[2-(2,3-dihydro-1H-inden-5-yl)acetyl]amino]thiourea (PubChem CID 8622189) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is 1-cyclopentyl-3-[[2-(2,3-dihydro-1H-inden-5-yl)acetyl]amino]thiourea.
| Compound Name | 1-cyclopentyl-3-[[2-(2,3-dihydro-1H-inden-5-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 8622189 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 1-cyclopentyl-3-[[2-(2,3-dihydro-1H-inden-5-yl)acetyl]amino]thiourea |
| SMILES | O=C(Cc1ccc2c(c1)CCC2)NNC(=S)NC1CCCC1 |
| InChI | InChI=1S/C17H23N3OS/c21-16(19-20-17(22)18-15-6-1-2-7-15)11-12-8-9-13-4-3-5-14(13)10-12/h8-10,15H,1-7,11H2,(H,19,21)(H2,18,20,22) |
| InChIKey | MPEQCLFALRYIPJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|