C13H17N3OS — CID 87566146
[[2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetyl]amino]thiourea (PubChem CID 87566146) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is [[2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetyl]amino]thiourea.
| Compound Name | [[2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 87566146 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | [[2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetyl]amino]thiourea |
| SMILES | NC(=S)NNC(=O)Cc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C13H17N3OS/c14-13(18)16-15-12(17)8-9-5-6-10-3-1-2-4-11(10)7-9/h5-7H,1-4,8H2,(H,15,17)(H3,14,16,18) |
| InChIKey | YURKKWRAFLJUCV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|