C13H17N — CID 43560294
N-(cyclopropylmethyl)-2,3-dihydro-1H-inden-5-amine (PubChem CID 43560294) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2,3-dihydro-1H-inden-5-amine.
| Compound Name | N-(cyclopropylmethyl)-2,3-dihydro-1H-inden-5-amine |
|---|---|
| PubChem CID | 43560294 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | N-(cyclopropylmethyl)-2,3-dihydro-1H-inden-5-amine |
| SMILES | c1cc2c(cc1NCC1CC1)CCC2 |
| InChI | InChI=1S/C13H17N/c1-2-11-6-7-13(8-12(11)3-1)14-9-10-4-5-10/h6-8,10,14H,1-5,9H2 |
| InChIKey | FUURDZBSXPVHLT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |