C11H14BrN — CID 115261521
N-(bromomethyl)-5,6,7,8-tetrahydronaphthalen-2-amine (PubChem CID 115261521) has the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. Its IUPAC name is N-(bromomethyl)-5,6,7,8-tetrahydronaphthalen-2-amine.
| Compound Name | N-(bromomethyl)-5,6,7,8-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 115261521 |
| Molecular Formula | C11H14BrN |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | N-(bromomethyl)-5,6,7,8-tetrahydronaphthalen-2-amine |
| SMILES | BrCNc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C11H14BrN/c12-8-13-11-6-5-9-3-1-2-4-10(9)7-11/h5-7,13H,1-4,8H2 |
| InChIKey | QMHILGJQJHDUNO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|