C15H25N — CID 167619505
N-tert-butyl-2,3-dihydro-1H-inden-5-amine;ethane (PubChem CID 167619505) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N-tert-butyl-2,3-dihydro-1H-inden-5-amine;ethane.
| Compound Name | N-tert-butyl-2,3-dihydro-1H-inden-5-amine;ethane |
|---|---|
| PubChem CID | 167619505 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N-tert-butyl-2,3-dihydro-1H-inden-5-amine;ethane |
| SMILES | CC.CC(C)(C)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H19N.C2H6/c1-13(2,3)14-12-8-7-10-5-4-6-11(10)9-12;1-2/h7-9,14H,4-6H2,1-3H3;1-2H3 |
| InChIKey | MFRNBDGTFRQKCX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |