C17H25N — CID 43096766
N-(2,6-dimethylcyclohexyl)-2,3-dihydro-1H-inden-5-amine (PubChem CID 43096766) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is N-(2,6-dimethylcyclohexyl)-2,3-dihydro-1H-inden-5-amine.
| Compound Name | N-(2,6-dimethylcyclohexyl)-2,3-dihydro-1H-inden-5-amine |
|---|---|
| PubChem CID | 43096766 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | N-(2,6-dimethylcyclohexyl)-2,3-dihydro-1H-inden-5-amine |
| SMILES | CC1CCCC(C)C1Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H25N/c1-12-5-3-6-13(2)17(12)18-16-10-9-14-7-4-8-15(14)11-16/h9-13,17-18H,3-8H2,1-2H3 |
| InChIKey | MLKXQAXNXKENJO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |