C14H20FNO — CID 64792592
4-[(2,6-dimethylcyclohexyl)amino]-2-fluorophenol (PubChem CID 64792592) has the molecular formula C14H20FNO and a molecular weight of 237.32 g/mol. Its IUPAC name is 4-[(2,6-dimethylcyclohexyl)amino]-2-fluorophenol.
| Compound Name | 4-[(2,6-dimethylcyclohexyl)amino]-2-fluorophenol |
|---|---|
| PubChem CID | 64792592 |
| Molecular Formula | C14H20FNO |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 4-[(2,6-dimethylcyclohexyl)amino]-2-fluorophenol |
| SMILES | CC1CCCC(C)C1Nc1ccc(O)c(F)c1 |
| InChI | InChI=1S/C14H20FNO/c1-9-4-3-5-10(2)14(9)16-11-6-7-13(17)12(15)8-11/h6-10,14,16-17H,3-5H2,1-2H3 |
| InChIKey | PGONGZBMGHBAOZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|