C14H19F2N — CID 64776370
N-(2,3-dimethylcyclohexyl)-3,4-difluoroaniline (PubChem CID 64776370) has the molecular formula C14H19F2N and a molecular weight of 239.31 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-3,4-difluoroaniline.
| Compound Name | N-(2,3-dimethylcyclohexyl)-3,4-difluoroaniline |
|---|---|
| PubChem CID | 64776370 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-3,4-difluoroaniline |
| SMILES | CC1CCCC(Nc2ccc(F)c(F)c2)C1C |
| InChI | InChI=1S/C14H19F2N/c1-9-4-3-5-14(10(9)2)17-11-6-7-12(15)13(16)8-11/h6-10,14,17H,3-5H2,1-2H3 |
| InChIKey | VFLJYNPAKQPADJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |