C13H19FN2 — CID 104586722
N-(2,3-dimethylcyclohexyl)-6-fluoropyridin-3-amine (PubChem CID 104586722) has the molecular formula C13H19FN2 and a molecular weight of 222.31 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-6-fluoropyridin-3-amine.
| Compound Name | N-(2,3-dimethylcyclohexyl)-6-fluoropyridin-3-amine |
|---|---|
| PubChem CID | 104586722 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-6-fluoropyridin-3-amine |
| SMILES | CC1CCCC(Nc2ccc(F)nc2)C1C |
| InChI | InChI=1S/C13H19FN2/c1-9-4-3-5-12(10(9)2)16-11-6-7-13(14)15-8-11/h6-10,12,16H,3-5H2,1-2H3 |
| InChIKey | GREYPXSKEQJTFL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|