C15H20N2 — CID 43079582
4-[(2,3-dimethylcyclohexyl)amino]benzonitrile (PubChem CID 43079582) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 4-[(2,3-dimethylcyclohexyl)amino]benzonitrile.
| Compound Name | 4-[(2,3-dimethylcyclohexyl)amino]benzonitrile |
|---|---|
| PubChem CID | 43079582 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 4-[(2,3-dimethylcyclohexyl)amino]benzonitrile |
| SMILES | CC1CCCC(Nc2ccc(C#N)cc2)C1C |
| InChI | InChI=1S/C15H20N2/c1-11-4-3-5-15(12(11)2)17-14-8-6-13(10-16)7-9-14/h6-9,11-12,15,17H,3-5H2,1-2H3 |
| InChIKey | QEHGJPMOEIHGPA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |