C14H15N3 — CID 107788162
4-[(2-methylcyclopentyl)amino]benzene-1,2-dicarbonitrile (PubChem CID 107788162) has the molecular formula C14H15N3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 4-[(2-methylcyclopentyl)amino]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[(2-methylcyclopentyl)amino]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 107788162 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 4-[(2-methylcyclopentyl)amino]benzene-1,2-dicarbonitrile |
| SMILES | CC1CCCC1Nc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C14H15N3/c1-10-3-2-4-14(10)17-13-6-5-11(8-15)12(7-13)9-16/h5-7,10,14,17H,2-4H2,1H3 |
| InChIKey | HKIGANVAPQADOQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |