C11H11BrN2 — CID 107276281
2-bromo-4-[(2-methylcyclopropyl)amino]benzonitrile (PubChem CID 107276281) has the molecular formula C11H11BrN2 and a molecular weight of 251.13 g/mol. Its IUPAC name is 2-bromo-4-[(2-methylcyclopropyl)amino]benzonitrile.
| Compound Name | 2-bromo-4-[(2-methylcyclopropyl)amino]benzonitrile |
|---|---|
| PubChem CID | 107276281 |
| Molecular Formula | C11H11BrN2 |
| Molecular Weight | 251.13 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 2-bromo-4-[(2-methylcyclopropyl)amino]benzonitrile |
| SMILES | CC1CC1Nc1ccc(C#N)c(Br)c1 |
| InChI | InChI=1S/C11H11BrN2/c1-7-4-11(7)14-9-3-2-8(6-13)10(12)5-9/h2-3,5,7,11,14H,4H2,1H3 |
| InChIKey | FAFCYKRZEYBWTJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.13 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |