C17H15BrN2 — CID 107276271
2-bromo-4-(1,2,3,4-tetrahydronaphthalen-1-ylamino)benzonitrile (PubChem CID 107276271) has the molecular formula C17H15BrN2 and a molecular weight of 327.23 g/mol. Its IUPAC name is 2-bromo-4-(1,2,3,4-tetrahydronaphthalen-1-ylamino)benzonitrile.
| Compound Name | 2-bromo-4-(1,2,3,4-tetrahydronaphthalen-1-ylamino)benzonitrile |
|---|---|
| PubChem CID | 107276271 |
| Molecular Formula | C17H15BrN2 |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 2-bromo-4-(1,2,3,4-tetrahydronaphthalen-1-ylamino)benzonitrile |
| SMILES | N#Cc1ccc(NC2CCCc3ccccc32)cc1Br |
| InChI | InChI=1S/C17H15BrN2/c18-16-10-14(9-8-13(16)11-19)20-17-7-3-5-12-4-1-2-6-15(12)17/h1-2,4,6,8-10,17,20H,3,5,7H2 |
| InChIKey | BUQSOMUWEBYIMX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |