C18H20IN — CID 43716262
N-(3-iodo-4-methylphenyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine (PubChem CID 43716262) has the molecular formula C18H20IN and a molecular weight of 377.27 g/mol. Its IUPAC name is N-(3-iodo-4-methylphenyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine.
| Compound Name | N-(3-iodo-4-methylphenyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine |
|---|---|
| PubChem CID | 43716262 |
| Molecular Formula | C18H20IN |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | N-(3-iodo-4-methylphenyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine |
| SMILES | Cc1ccc(NC2CCCCc3ccccc32)cc1I |
| InChI | InChI=1S/C18H20IN/c1-13-10-11-15(12-17(13)19)20-18-9-5-3-7-14-6-2-4-8-16(14)18/h2,4,6,8,10-12,18,20H,3,5,7,9H2,1H3 |
| InChIKey | RXMRFVOANWPKGF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|