C20H25N — CID 63448599
N-(2,4,6-trimethylphenyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine (PubChem CID 63448599) has the molecular formula C20H25N and a molecular weight of 279.43 g/mol. Its IUPAC name is N-(2,4,6-trimethylphenyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine.
| Compound Name | N-(2,4,6-trimethylphenyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine |
|---|---|
| PubChem CID | 63448599 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | N-(2,4,6-trimethylphenyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine |
| SMILES | Cc1cc(C)c(NC2CCCCc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C20H25N/c1-14-12-15(2)20(16(3)13-14)21-19-11-7-5-9-17-8-4-6-10-18(17)19/h4,6,8,10,12-13,19,21H,5,7,9,11H2,1-3H3 |
| InChIKey | TZMZDNVLJYEMHU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |