C21H19NO2 — CID 92686716
3-(4-methylphenyl)-4-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 92686716) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 3-(4-methylphenyl)-4-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(4-methylphenyl)-4-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 92686716 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3-(4-methylphenyl)-4-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | Cc1ccc(-c2c(N[C@H]3CCCc4ccccc43)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C21H19NO2/c1-13-9-11-15(12-10-13)18-19(21(24)20(18)23)22-17-8-4-6-14-5-2-3-7-16(14)17/h2-3,5,7,9-12,17,22H,4,6,8H2,1H3/t17-/m0/s1 |
| InChIKey | JKGLUPOJVUNKBR-KRWDZBQOSA-N |
| XLogP | 3.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|