C17H17FIN — CID 79769381
N-(4-fluoro-2-iodophenyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine (PubChem CID 79769381) has the molecular formula C17H17FIN and a molecular weight of 381.23 g/mol. Its IUPAC name is N-(4-fluoro-2-iodophenyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine.
| Compound Name | N-(4-fluoro-2-iodophenyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine |
|---|---|
| PubChem CID | 79769381 |
| Molecular Formula | C17H17FIN |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | N-(4-fluoro-2-iodophenyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine |
| SMILES | Fc1ccc(NC2CCCCc3ccccc32)c(I)c1 |
| InChI | InChI=1S/C17H17FIN/c18-13-9-10-17(15(19)11-13)20-16-8-4-2-6-12-5-1-3-7-14(12)16/h1,3,5,7,9-11,16,20H,2,4,6,8H2 |
| InChIKey | WIGJOWIHKCYJIB-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|