C17H23BrN2 — CID 107276645
2-bromo-4-[(3,3,5,5-tetramethylcyclohexyl)amino]benzonitrile (PubChem CID 107276645) has the molecular formula C17H23BrN2 and a molecular weight of 335.29 g/mol. Its IUPAC name is 2-bromo-4-[(3,3,5,5-tetramethylcyclohexyl)amino]benzonitrile.
| Compound Name | 2-bromo-4-[(3,3,5,5-tetramethylcyclohexyl)amino]benzonitrile |
|---|---|
| PubChem CID | 107276645 |
| Molecular Formula | C17H23BrN2 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-bromo-4-[(3,3,5,5-tetramethylcyclohexyl)amino]benzonitrile |
| SMILES | CC1(C)CC(Nc2ccc(C#N)c(Br)c2)CC(C)(C)C1 |
| InChI | InChI=1S/C17H23BrN2/c1-16(2)8-14(9-17(3,4)11-16)20-13-6-5-12(10-19)15(18)7-13/h5-7,14,20H,8-9,11H2,1-4H3 |
| InChIKey | XKYCLLVMUFKBHB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |