C17H25N3 — CID 103965284
5-amino-2-[(3,3,5,5-tetramethylcyclohexyl)amino]benzonitrile (PubChem CID 103965284) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 5-amino-2-[(3,3,5,5-tetramethylcyclohexyl)amino]benzonitrile.
| Compound Name | 5-amino-2-[(3,3,5,5-tetramethylcyclohexyl)amino]benzonitrile |
|---|---|
| PubChem CID | 103965284 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 5-amino-2-[(3,3,5,5-tetramethylcyclohexyl)amino]benzonitrile |
| SMILES | CC1(C)CC(Nc2ccc(N)cc2C#N)CC(C)(C)C1 |
| InChI | InChI=1S/C17H25N3/c1-16(2)8-14(9-17(3,4)11-16)20-15-6-5-13(19)7-12(15)10-18/h5-7,14,20H,8-9,11,19H2,1-4H3 |
| InChIKey | YEWGBSRCVAUMSO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|