C18H26N2 — CID 107803202
2-methyl-6-[(3,3,5,5-tetramethylcyclohexyl)amino]benzonitrile (PubChem CID 107803202) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 2-methyl-6-[(3,3,5,5-tetramethylcyclohexyl)amino]benzonitrile.
| Compound Name | 2-methyl-6-[(3,3,5,5-tetramethylcyclohexyl)amino]benzonitrile |
|---|---|
| PubChem CID | 107803202 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 2-methyl-6-[(3,3,5,5-tetramethylcyclohexyl)amino]benzonitrile |
| SMILES | Cc1cccc(NC2CC(C)(C)CC(C)(C)C2)c1C#N |
| InChI | InChI=1S/C18H26N2/c1-13-7-6-8-16(15(13)11-19)20-14-9-17(2,3)12-18(4,5)10-14/h6-8,14,20H,9-10,12H2,1-5H3 |
| InChIKey | WNVQPBIXWYXMSI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |