C14H18N2O — CID 107804318
2-[[(1R,2R)-2-hydroxycyclohexyl]amino]-6-methylbenzonitrile (PubChem CID 107804318) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-[[(1R,2R)-2-hydroxycyclohexyl]amino]-6-methylbenzonitrile.
| Compound Name | 2-[[(1R,2R)-2-hydroxycyclohexyl]amino]-6-methylbenzonitrile |
|---|---|
| PubChem CID | 107804318 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 2-[[(1R,2R)-2-hydroxycyclohexyl]amino]-6-methylbenzonitrile |
| SMILES | Cc1cccc(N[C@@H]2CCCC[C@H]2O)c1C#N |
| InChI | InChI=1S/C14H18N2O/c1-10-5-4-7-12(11(10)9-15)16-13-6-2-3-8-14(13)17/h4-5,7,13-14,16-17H,2-3,6,8H2,1H3/t13-,14-/m1/s1 |
| InChIKey | URHKSBTZEPYQHF-ZIAGYGMSSA-N |
| XLogP | 2.58 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |