About N-(2,5-dimethylcyclohexyl)-3,4-difluoroaniline
N-(2,5-dimethylcyclohexyl)-3,4-difluoroaniline (PubChem CID 64776575) has the molecular formula C14H19F2N
and a molecular weight of 239.31 g/mol. Its IUPAC name is N-(2,5-dimethylcyclohexyl)-3,4-difluoroaniline.
Molecular Properties
| Compound Name | N-(2,5-dimethylcyclohexyl)-3,4-difluoroaniline |
| PubChem CID | 64776575 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-(2,5-dimethylcyclohexyl)-3,4-difluoroaniline |
| SMILES | CC1CCC(C)C(Nc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C14H19F2N/c1-9-3-4-10(2)14(7-9)17-11-5-6-12(15)13(16)8-11/h5-6,8-10,14,17H,3-4,7H2,1-2H3 |
| InChIKey | QVFCHKQBEAZGFX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2,5-dimethylcyclohexyl)-3,4-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-dimethylcyclohexyl)-3,4-difluoroaniline?
The IUPAC name of N-(2,5-dimethylcyclohexyl)-3,4-difluoroaniline (CID 64776575) is N-(2,5-dimethylcyclohexyl)-3,4-difluoroaniline.
What is the SMILES notation for N-(2,5-dimethylcyclohexyl)-3,4-difluoroaniline?
The canonical SMILES for N-(2,5-dimethylcyclohexyl)-3,4-difluoroaniline is CC1CCC(C)C(Nc2ccc(F)c(F)c2)C1.
What is the InChIKey of N-(2,5-dimethylcyclohexyl)-3,4-difluoroaniline?
The InChIKey is QVFCHKQBEAZGFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F2N/c1-9-3-4-10(2)14(7-9)17-11-5-6-12(15)13(16)8-11/h5-6,8-10,14,17H,3-4,7H2,1-2H3.
What are the key properties of N-(2,5-dimethylcyclohexyl)-3,4-difluoroaniline?
N-(2,5-dimethylcyclohexyl)-3,4-difluoroaniline has a molecular weight of 239.31 g/mol, XLogP of 4.20, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-dimethylcyclohexyl)-3,4-difluoroaniline is sourced from PubChem (CID 64776575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).