C20H31N — CID 137448864
N-cyclohexyl-5,6,7,8,9,10,11,12-octahydrobenzo[10]annulen-3-amine (PubChem CID 137448864) has the molecular formula C20H31N and a molecular weight of 285.47 g/mol. Its IUPAC name is N-cyclohexyl-5,6,7,8,9,10,11,12-octahydrobenzo[10]annulen-3-amine.
| Compound Name | N-cyclohexyl-5,6,7,8,9,10,11,12-octahydrobenzo[10]annulen-3-amine |
|---|---|
| PubChem CID | 137448864 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | N-cyclohexyl-5,6,7,8,9,10,11,12-octahydrobenzo[10]annulen-3-amine |
| SMILES | c1cc2c(cc1NC1CCCCC1)CCCCCCCC2 |
| InChI | InChI=1S/C20H31N/c1-2-4-7-11-18-16-20(15-14-17(18)10-6-3-1)21-19-12-8-5-9-13-19/h14-16,19,21H,1-13H2 |
| InChIKey | IHWCATVDCZJSDU-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |