C13H15NO — CID 83819396
6-(cyclopropylamino)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 83819396) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 6-(cyclopropylamino)-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 6-(cyclopropylamino)-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 83819396 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 6-(cyclopropylamino)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1CCCc2cc(NC3CC3)ccc21 |
| InChI | InChI=1S/C13H15NO/c15-13-3-1-2-9-8-11(6-7-12(9)13)14-10-4-5-10/h6-8,10,14H,1-5H2 |
| InChIKey | NGAGHRBUSCRTII-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |