C11H12O2 — CID 11959102
2-hydroxy-6,7,8,9-tetrahydrobenzo[7]annulen-5-one (PubChem CID 11959102) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-hydroxy-6,7,8,9-tetrahydrobenzo[7]annulen-5-one.
| Compound Name | 2-hydroxy-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
|---|---|
| PubChem CID | 11959102 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 2-hydroxy-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
| SMILES | O=C1CCCCc2cc(O)ccc21 |
| InChI | InChI=1S/C11H12O2/c12-9-5-6-10-8(7-9)3-1-2-4-11(10)13/h5-7,12H,1-4H2 |
| InChIKey | LCEJOJCDTXCOCR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |