C12H16O2 — CID 54451343
ethane;7-hydroxy-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 54451343) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is ethane;7-hydroxy-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | ethane;7-hydroxy-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 54451343 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | ethane;7-hydroxy-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CC.O=C1CCCc2ccc(O)cc21 |
| InChI | InChI=1S/C10H10O2.C2H6/c11-8-5-4-7-2-1-3-10(12)9(7)6-8;1-2/h4-6,11H,1-3H2;1-2H3 |
| InChIKey | WVEWFUINMGTDRS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |