C13H18OSn — CID 15224570
7-trimethylstannyl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 15224570) has the molecular formula C13H18OSn and a molecular weight of 309.00 g/mol. Its IUPAC name is 7-trimethylstannyl-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 7-trimethylstannyl-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 15224570 |
| Molecular Formula | C13H18OSn |
| Molecular Weight | 309.00 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 7-trimethylstannyl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | C[Sn](C)(C)c1ccc2c(c1)C(=O)CCC2 |
| InChI | InChI=1S/C10H9O.3CH3.Sn/c11-10-7-3-5-8-4-1-2-6-9(8)10;;;;/h1,4,6H,3,5,7H2;3*1H3; |
| InChIKey | BQJSGFNBZJPQOS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.00 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |