C12H12O2 — CID 54195655
7-acetyl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 54195655) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 7-acetyl-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 7-acetyl-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 54195655 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 7-acetyl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CC(=O)c1ccc2c(c1)C(=O)CCC2 |
| InChI | InChI=1S/C12H12O2/c1-8(13)10-6-5-9-3-2-4-12(14)11(9)7-10/h5-7H,2-4H2,1H3 |
| InChIKey | PLPNYENRAVFTSF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |