C14H20O — CID 123573357
ethane;1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone (PubChem CID 123573357) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is ethane;1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone.
| Compound Name | ethane;1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone |
|---|---|
| PubChem CID | 123573357 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | ethane;1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone |
| SMILES | CC.CC(=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C12H14O.C2H6/c1-9(13)11-7-6-10-4-2-3-5-12(10)8-11;1-2/h6-8H,2-5H2,1H3;1-2H3 |
| InChIKey | GZGPURYZMNIRLX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |