C17H18ClNO — CID 155718260
1-(4-aminophenyl)ethanone;5-chloro-2,3-dihydro-1H-indene (PubChem CID 155718260) has the molecular formula C17H18ClNO and a molecular weight of 287.79 g/mol. Its IUPAC name is 1-(4-aminophenyl)ethanone;5-chloro-2,3-dihydro-1H-indene.
| Compound Name | 1-(4-aminophenyl)ethanone;5-chloro-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 155718260 |
| Molecular Formula | C17H18ClNO |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 1-(4-aminophenyl)ethanone;5-chloro-2,3-dihydro-1H-indene |
| SMILES | CC(=O)c1ccc(N)cc1.Clc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C9H9Cl.C8H9NO/c10-9-5-4-7-2-1-3-8(7)6-9;1-6(10)7-2-4-8(9)5-3-7/h4-6H,1-3H2;2-5H,9H2,1H3 |
| InChIKey | XVKVUZYODUYSFI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|