C26H24ClNO — CID 169239235
1-[5-(4-aminophenyl)-6-(4-chloro-2-methylphenyl)-8,9-dihydro-7H-benzo[7]annulen-2-yl]ethanone (PubChem CID 169239235) has the molecular formula C26H24ClNO and a molecular weight of 401.94 g/mol. Its IUPAC name is 1-[5-(4-aminophenyl)-6-(4-chloro-2-methylphenyl)-8,9-dihydro-7H-benzo[7]annulen-2-yl]ethanone.
| Compound Name | 1-[5-(4-aminophenyl)-6-(4-chloro-2-methylphenyl)-8,9-dihydro-7H-benzo[7]annulen-2-yl]ethanone |
|---|---|
| PubChem CID | 169239235 |
| Molecular Formula | C26H24ClNO |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 1-[5-(4-aminophenyl)-6-(4-chloro-2-methylphenyl)-8,9-dihydro-7H-benzo[7]annulen-2-yl]ethanone |
| SMILES | CC(=O)c1ccc2c(c1)CCCC(c1ccc(Cl)cc1C)=C2c1ccc(N)cc1 |
| InChI | InChI=1S/C26H24ClNO/c1-16-14-21(27)9-13-23(16)25-5-3-4-20-15-19(17(2)29)8-12-24(20)26(25)18-6-10-22(28)11-7-18/h6-15H,3-5,28H2,1-2H3 |
| InChIKey | UDWQRSJASYVSFN-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|