C31H31BCl2O4 — CID 176849474
methyl 6-(2,4-dichlorophenyl)-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate (PubChem CID 176849474) has the molecular formula C31H31BCl2O4 and a molecular weight of 549.30 g/mol. Its IUPAC name is methyl 6-(2,4-dichlorophenyl)-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate.
| Compound Name | methyl 6-(2,4-dichlorophenyl)-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate |
|---|---|
| PubChem CID | 176849474 |
| Molecular Formula | C31H31BCl2O4 |
| Molecular Weight | 549.30 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | methyl 6-(2,4-dichlorophenyl)-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CCCC(c1ccc(Cl)cc1Cl)=C2c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C31H31BCl2O4/c1-30(2)31(3,4)38-32(37-30)22-12-9-19(10-13-22)28-24-15-11-21(29(35)36-5)17-20(24)7-6-8-26(28)25-16-14-23(33)18-27(25)34/h9-18H,6-8H2,1-5H3 |
| InChIKey | OZWNASHCMLGIAM-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.30 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|